![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Zombieland (2009) 10..> | 2020-03-15 21:08 | 2.2G | |
| Zombieland (2009) 10..> | 2020-03-15 21:08 | 2.2G | |
| Wanted 2009.720p.DVD..> | 2013-06-30 17:51 | 2.3G | |
| Tum Mile (2009) Hind..> | 2019-02-26 15:09 | 1.5G | |
| Love Aaj Kal .mp4 | 2014-08-24 13:42 | 588M | |
| Kambakkht Ishq (2009..> | 2022-09-09 04:15 | 1.0G | |
| Kal Kissne Dekha (20..> | 2024-03-06 09:32 | 1.6G | |
| De Dana Dan 2009 Blu..> | 2022-10-03 13:30 | 4.5G | |
| Chandni Chowk to Chi..> | 2019-12-30 01:37 | 3.9G | |
| Blue_2009_BluRay_720..> | 2022-10-03 13:49 | 1.0G | |
| Billu 2009 BluRay 10..> | 2022-08-17 19:55 | 3.6G | |
| All the Best Fun Beg..> | 2022-12-30 10:40 | 3.7G | |
| Aladin (2009) HDrip.mp4 | 2015-04-09 12:46 | 1.7G | |
| Ajab.Prem.Ki.Ghazab...> | 2009-12-25 20:28 | 842M | |
| Aa Dekhen Zara (2009..> | 2022-12-15 22:18 | 1.4G | |
| 99 2009 WebRip Hindi..> | 2019-01-19 22:33 | 1.5G | |
| 8 x 10 Tasveer 2009 ..> | 2022-10-17 11:46 | 1.1G | |
| 3.Idiots.2009.720p.B..> | 2019-01-28 13:03 | 2.6G | |